C18H29NOS — CID 79953352
5,5-dimethyl-N-[1-(4-propan-2-yloxyphenyl)ethyl]thian-3-amine (PubChem CID 79953352) has the molecular formula C18H29NOS and a molecular weight of 307.50 g/mol. Its IUPAC name is 5,5-dimethyl-N-[1-(4-propan-2-yloxyphenyl)ethyl]thian-3-amine.
| Compound Name | 5,5-dimethyl-N-[1-(4-propan-2-yloxyphenyl)ethyl]thian-3-amine |
|---|---|
| PubChem CID | 79953352 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 5,5-dimethyl-N-[1-(4-propan-2-yloxyphenyl)ethyl]thian-3-amine |
| SMILES | CC(C)Oc1ccc(C(C)NC2CSCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C18H29NOS/c1-13(2)20-17-8-6-15(7-9-17)14(3)19-16-10-18(4,5)12-21-11-16/h6-9,13-14,16,19H,10-12H2,1-5H3 |
| InChIKey | UTCFNAGNCAWHFZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |