C15H22BrNS — CID 81355183
N-[(1S)-1-(4-bromophenyl)ethyl]-5,5-dimethylthian-3-amine (PubChem CID 81355183) has the molecular formula C15H22BrNS and a molecular weight of 328.32 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-5,5-dimethylthian-3-amine.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 81355183 |
| Molecular Formula | C15H22BrNS |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-5,5-dimethylthian-3-amine |
| SMILES | C[C@H](NC1CSCC(C)(C)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H22BrNS/c1-11(12-4-6-13(16)7-5-12)17-14-8-15(2,3)10-18-9-14/h4-7,11,14,17H,8-10H2,1-3H3/t11-,14?/m0/s1 |
| InChIKey | LJCLFAJCGACQLA-ZSOXZCCMSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |