C12H15N3O3S — CID 55129787
4-(2,5-diethoxyphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 55129787) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-(2,5-diethoxyphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(2,5-diethoxyphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 55129787 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-(2,5-diethoxyphenyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | CCOc1ccc(OCC)c(-n2c(=O)[nH][nH]c2=S)c1 |
| InChI | InChI=1S/C12H15N3O3S/c1-3-17-8-5-6-10(18-4-2)9(7-8)15-11(16)13-14-12(15)19/h5-7H,3-4H2,1-2H3,(H,13,16)(H,14,19) |
| InChIKey | BVBPLUWUTOKCAB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|