C16H16N4O3S2 — CID 25171810
(5Z)-5-[[1-(2,5-diethoxyphenyl)triazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 25171810) has the molecular formula C16H16N4O3S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (5Z)-5-[[1-(2,5-diethoxyphenyl)triazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-(2,5-diethoxyphenyl)triazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 25171810 |
| Molecular Formula | C16H16N4O3S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (5Z)-5-[[1-(2,5-diethoxyphenyl)triazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(OCC)c(-n2cc(/C=C3\SC(=S)NC3=O)nn2)c1 |
| InChI | InChI=1S/C16H16N4O3S2/c1-3-22-11-5-6-13(23-4-2)12(8-11)20-9-10(18-19-20)7-14-15(21)17-16(24)25-14/h5-9H,3-4H2,1-2H3,(H,17,21,24)/b14-7- |
| InChIKey | UNXQRDYNLIIALK-AUWJEWJLSA-N |
| XLogP | 2.55 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|