C14H18N4 — CID 55130882
6-methyl-5-propan-2-yl-2-(pyridin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 55130882) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 6-methyl-5-propan-2-yl-2-(pyridin-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-methyl-5-propan-2-yl-2-(pyridin-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 55130882 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 6-methyl-5-propan-2-yl-2-(pyridin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Cc1nc(Cc2ccccn2)nc(N)c1C(C)C |
| InChI | InChI=1S/C14H18N4/c1-9(2)13-10(3)17-12(18-14(13)15)8-11-6-4-5-7-16-11/h4-7,9H,8H2,1-3H3,(H2,15,17,18) |
| InChIKey | DHJZHHWWOWQALE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |