C10H11N3S — CID 83107325
5-methyl-2-(pyridin-2-ylmethyl)-1,3-thiazol-4-amine (PubChem CID 83107325) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 5-methyl-2-(pyridin-2-ylmethyl)-1,3-thiazol-4-amine.
| Compound Name | 5-methyl-2-(pyridin-2-ylmethyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 83107325 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-methyl-2-(pyridin-2-ylmethyl)-1,3-thiazol-4-amine |
| SMILES | Cc1sc(Cc2ccccn2)nc1N |
| InChI | InChI=1S/C10H11N3S/c1-7-10(11)13-9(14-7)6-8-4-2-3-5-12-8/h2-5H,6,11H2,1H3 |
| InChIKey | FDYWEJKUHDFZGM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |