C10H11N5 — CID 175978726
4-(pyridin-2-ylmethyl)pyridazine-3,5-diamine (PubChem CID 175978726) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-(pyridin-2-ylmethyl)pyridazine-3,5-diamine.
| Compound Name | 4-(pyridin-2-ylmethyl)pyridazine-3,5-diamine |
|---|---|
| PubChem CID | 175978726 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-(pyridin-2-ylmethyl)pyridazine-3,5-diamine |
| SMILES | Nc1cnnc(N)c1Cc1ccccn1 |
| InChI | InChI=1S/C10H11N5/c11-9-6-14-15-10(12)8(9)5-7-3-1-2-4-13-7/h1-4,6H,5H2,(H4,11,12,15) |
| InChIKey | CKLUWFGJOROKSM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |