C14H17ClN6 — CID 71850443
5-chloro-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]pyridazin-4-amine (PubChem CID 71850443) has the molecular formula C14H17ClN6 and a molecular weight of 304.78 g/mol. Its IUPAC name is 5-chloro-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]pyridazin-4-amine.
| Compound Name | 5-chloro-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]pyridazin-4-amine |
|---|---|
| PubChem CID | 71850443 |
| Molecular Formula | C14H17ClN6 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 5-chloro-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]pyridazin-4-amine |
| SMILES | Nc1cnnc(N2CCN(Cc3ccccn3)CC2)c1Cl |
| InChI | InChI=1S/C14H17ClN6/c15-13-12(16)9-18-19-14(13)21-7-5-20(6-8-21)10-11-3-1-2-4-17-11/h1-4,9H,5-8,10H2,(H2,16,19) |
| InChIKey | ZXZHEBWICOXXJV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |