C11H15N3O2 — CID 55136511
N-(3-cyanopentan-3-yl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 55136511) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(3-cyanopentan-3-yl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(3-cyanopentan-3-yl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 55136511 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-(3-cyanopentan-3-yl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCC(C#N)(CC)NC(=O)c1cnoc1C |
| InChI | InChI=1S/C11H15N3O2/c1-4-11(5-2,7-12)14-10(15)9-6-13-16-8(9)3/h6H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | YJQKPFBZCCKVAZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |