C10H13F3N2O — CID 55138729
N-(1-cyano-4-methylcyclohexyl)-2,2,2-trifluoroacetamide (PubChem CID 55138729) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is N-(1-cyano-4-methylcyclohexyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1-cyano-4-methylcyclohexyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 55138729 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-(1-cyano-4-methylcyclohexyl)-2,2,2-trifluoroacetamide |
| SMILES | CC1CCC(C#N)(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H13F3N2O/c1-7-2-4-9(6-14,5-3-7)15-8(16)10(11,12)13/h7H,2-5H2,1H3,(H,15,16) |
| InChIKey | PDQISRYLLXAFSA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |