C12H17F3N2O — CID 61118959
N-(1-cyano-4-ethylcyclohexyl)-3,3,3-trifluoropropanamide (PubChem CID 61118959) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is N-(1-cyano-4-ethylcyclohexyl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(1-cyano-4-ethylcyclohexyl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 61118959 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(1-cyano-4-ethylcyclohexyl)-3,3,3-trifluoropropanamide |
| SMILES | CCC1CCC(C#N)(NC(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H17F3N2O/c1-2-9-3-5-11(8-16,6-4-9)17-10(18)7-12(13,14)15/h9H,2-7H2,1H3,(H,17,18) |
| InChIKey | HTPKMZATZCLPRP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |