About N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide
N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide (PubChem CID 61119734) has the molecular formula C11H15F3N2O
and a molecular weight of 248.25 g/mol. Its IUPAC name is N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide |
| PubChem CID | 61119734 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide |
| SMILES | CC1CCC(C#N)(NC(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3N2O/c1-8-2-4-10(7-15,5-3-8)16-9(17)6-11(12,13)14/h8H,2-6H2,1H3,(H,16,17) |
| InChIKey | ABNUEWUKQSEKID-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide (CID 61119734) is N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide is CC1CCC(C#N)(NC(=O)CC(F)(F)F)CC1.
What is the InChIKey of N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide?
The InChIKey is ABNUEWUKQSEKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N2O/c1-8-2-4-10(7-15,5-3-8)16-9(17)6-11(12,13)14/h8H,2-6H2,1H3,(H,16,17).
What are the key properties of N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide?
N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide has a molecular weight of 248.25 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyano-4-methylcyclohexyl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 61119734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).