C11H14F2N2O — CID 118309341
N-(1-cyanocyclopropyl)-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 118309341) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(1-cyanocyclopropyl)-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118309341 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | N-(1-cyanocyclopropyl)-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | N#CC1(NC(=O)C2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C11H14F2N2O/c12-11(13)3-1-8(2-4-11)9(16)15-10(7-14)5-6-10/h8H,1-6H2,(H,15,16) |
| InChIKey | LWIPKXNJGSMMBE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |