C12H18F2N2O — CID 163494021
(2S)-N-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanamide (PubChem CID 163494021) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is (2S)-N-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanamide.
| Compound Name | (2S)-N-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanamide |
|---|---|
| PubChem CID | 163494021 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (2S)-N-(1-cyanocyclopropyl)-4,4-difluoro-2-methylheptanamide |
| SMILES | CCCC(F)(F)C[C@H](C)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C12H18F2N2O/c1-3-4-12(13,14)7-9(2)10(17)16-11(8-15)5-6-11/h9H,3-7H2,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | CPDADLZJESIRAK-VIFPVBQESA-N |
| XLogP | 2.62 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |