C15H21FN2O — CID 55148889
8-[(3-fluoro-4-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 55148889) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is 8-[(3-fluoro-4-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | 8-[(3-fluoro-4-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 55148889 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 8-[(3-fluoro-4-methoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | COc1ccc(CN2C3CCC2CC(N)C3)cc1F |
| InChI | InChI=1S/C15H21FN2O/c1-19-15-5-2-10(6-14(15)16)9-18-12-3-4-13(18)8-11(17)7-12/h2,5-6,11-13H,3-4,7-9,17H2,1H3 |
| InChIKey | NMVVBUFNUWZANR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |