C12H12N6O — CID 55157356
N-(5-amino-2-methylphenyl)-2-(3-cyano-1,2,4-triazol-1-yl)acetamide (PubChem CID 55157356) has the molecular formula C12H12N6O and a molecular weight of 256.27 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-2-(3-cyano-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(5-amino-2-methylphenyl)-2-(3-cyano-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 55157356 |
| Molecular Formula | C12H12N6O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-2-(3-cyano-1,2,4-triazol-1-yl)acetamide |
| SMILES | Cc1ccc(N)cc1NC(=O)Cn1cnc(C#N)n1 |
| InChI | InChI=1S/C12H12N6O/c1-8-2-3-9(14)4-10(8)16-12(19)6-18-7-15-11(5-13)17-18/h2-4,7H,6,14H2,1H3,(H,16,19) |
| InChIKey | MHQGUVAXGPIGDJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|