C12H15F2NO3S — CID 55167560
N-[2-(2,5-difluorophenoxy)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 55167560) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is N-[2-(2,5-difluorophenoxy)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[2-(2,5-difluorophenoxy)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 55167560 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[2-(2,5-difluorophenoxy)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCCOc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C12H15F2NO3S/c13-9-1-2-11(14)12(7-9)18-5-4-15-10-3-6-19(16,17)8-10/h1-2,7,10,15H,3-6,8H2 |
| InChIKey | VUKBTJDLTNSQSK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|