C15H21NO3S — CID 62584532
1,1-dioxo-N-[2-(2-prop-2-enylphenoxy)ethyl]thiolan-3-amine (PubChem CID 62584532) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 1,1-dioxo-N-[2-(2-prop-2-enylphenoxy)ethyl]thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-[2-(2-prop-2-enylphenoxy)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 62584532 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1,1-dioxo-N-[2-(2-prop-2-enylphenoxy)ethyl]thiolan-3-amine |
| SMILES | C=CCc1ccccc1OCCNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21NO3S/c1-2-5-13-6-3-4-7-15(13)19-10-9-16-14-8-11-20(17,18)12-14/h2-4,6-7,14,16H,1,5,8-12H2 |
| InChIKey | OXFRARQJQRXZDI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|