C11H19N3O3S — CID 55174161
2-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 55174161) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 55174161 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[[1-cyanopropan-2-yl(methyl)carbamoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)N(C)C(C)CC#N)C(=O)O |
| InChI | InChI=1S/C11H19N3O3S/c1-8(4-6-12)14(2)11(17)13-9(10(15)16)5-7-18-3/h8-9H,4-5,7H2,1-3H3,(H,13,17)(H,15,16) |
| InChIKey | PULRNBCDRKBCAD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |