C14H19N3O2 — CID 55175904
2-[1-cyanopropan-2-yl(methyl)amino]-N-(2-methoxyphenyl)acetamide (PubChem CID 55175904) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[1-cyanopropan-2-yl(methyl)amino]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[1-cyanopropan-2-yl(methyl)amino]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55175904 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[1-cyanopropan-2-yl(methyl)amino]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN(C)C(C)CC#N |
| InChI | InChI=1S/C14H19N3O2/c1-11(8-9-15)17(2)10-14(18)16-12-6-4-5-7-13(12)19-3/h4-7,11H,8,10H2,1-3H3,(H,16,18) |
| InChIKey | URYNKCVIKJUDQZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |