C12H14ClF3N2S — CID 55179837
4-chloro-2-[propan-2-yl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide (PubChem CID 55179837) has the molecular formula C12H14ClF3N2S and a molecular weight of 310.77 g/mol. Its IUPAC name is 4-chloro-2-[propan-2-yl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide.
| Compound Name | 4-chloro-2-[propan-2-yl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 55179837 |
| Molecular Formula | C12H14ClF3N2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 4-chloro-2-[propan-2-yl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide |
| SMILES | CC(C)N(CC(F)(F)F)c1cc(Cl)ccc1C(N)=S |
| InChI | InChI=1S/C12H14ClF3N2S/c1-7(2)18(6-12(14,15)16)10-5-8(13)3-4-9(10)11(17)19/h3-5,7H,6H2,1-2H3,(H2,17,19) |
| InChIKey | SLPKMUPJLHNUDQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|