C13H17F3N2S — CID 55008708
3-methyl-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide (PubChem CID 55008708) has the molecular formula C13H17F3N2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 3-methyl-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide.
| Compound Name | 3-methyl-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 55008708 |
| Molecular Formula | C13H17F3N2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-methyl-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]benzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)ccc1N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C13H17F3N2S/c1-8(2)18(7-13(14,15)16)11-5-4-10(12(17)19)6-9(11)3/h4-6,8H,7H2,1-3H3,(H2,17,19) |
| InChIKey | VXTZSSYXKTZNBF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|