C12H17F3N2 — CID 62590706
4-methyl-3-N-propan-2-yl-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine (PubChem CID 62590706) has the molecular formula C12H17F3N2 and a molecular weight of 246.28 g/mol. Its IUPAC name is 4-methyl-3-N-propan-2-yl-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine.
| Compound Name | 4-methyl-3-N-propan-2-yl-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 62590706 |
| Molecular Formula | C12H17F3N2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 4-methyl-3-N-propan-2-yl-3-N-(2,2,2-trifluoroethyl)benzene-1,3-diamine |
| SMILES | Cc1ccc(N)cc1N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H17F3N2/c1-8(2)17(7-12(13,14)15)11-6-10(16)5-4-9(11)3/h4-6,8H,7,16H2,1-3H3 |
| InChIKey | DQXWKRFEFNAJQS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|