C17H30N2 — CID 107869155
4-methyl-3-N,3-N-bis(3-methylbutyl)benzene-1,3-diamine (PubChem CID 107869155) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-methyl-3-N,3-N-bis(3-methylbutyl)benzene-1,3-diamine.
| Compound Name | 4-methyl-3-N,3-N-bis(3-methylbutyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 107869155 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 4-methyl-3-N,3-N-bis(3-methylbutyl)benzene-1,3-diamine |
| SMILES | Cc1ccc(N)cc1N(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C17H30N2/c1-13(2)8-10-19(11-9-14(3)4)17-12-16(18)7-6-15(17)5/h6-7,12-14H,8-11,18H2,1-5H3 |
| InChIKey | NUZCXJCDALTUQL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|