C14H14F2N2O — CID 55188923
2-cyclopropyl-8-(difluoromethoxy)-N-methylquinolin-4-amine (PubChem CID 55188923) has the molecular formula C14H14F2N2O and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-cyclopropyl-8-(difluoromethoxy)-N-methylquinolin-4-amine.
| Compound Name | 2-cyclopropyl-8-(difluoromethoxy)-N-methylquinolin-4-amine |
|---|---|
| PubChem CID | 55188923 |
| Molecular Formula | C14H14F2N2O |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-cyclopropyl-8-(difluoromethoxy)-N-methylquinolin-4-amine |
| SMILES | CNc1cc(C2CC2)nc2c(OC(F)F)cccc12 |
| InChI | InChI=1S/C14H14F2N2O/c1-17-11-7-10(8-5-6-8)18-13-9(11)3-2-4-12(13)19-14(15)16/h2-4,7-8,14H,5-6H2,1H3,(H,17,18) |
| InChIKey | JYKIPEQXKGQYBJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |