C14H16F2N2O — CID 62195939
8-(difluoromethoxy)-3-ethyl-N,2-dimethylquinolin-4-amine (PubChem CID 62195939) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is 8-(difluoromethoxy)-3-ethyl-N,2-dimethylquinolin-4-amine.
| Compound Name | 8-(difluoromethoxy)-3-ethyl-N,2-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 62195939 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 8-(difluoromethoxy)-3-ethyl-N,2-dimethylquinolin-4-amine |
| SMILES | CCc1c(C)nc2c(OC(F)F)cccc2c1NC |
| InChI | InChI=1S/C14H16F2N2O/c1-4-9-8(2)18-13-10(12(9)17-3)6-5-7-11(13)19-14(15)16/h5-7,14H,4H2,1-3H3,(H,17,18) |
| InChIKey | YRBNTWNDPQVQKK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |