C15H28N2O2 — CID 551898
N,N,N',N'-tetraethyl-2-propan-2-ylidenebutanediamide (PubChem CID 551898) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N,N,N',N'-tetraethyl-2-propan-2-ylidenebutanediamide.
| Compound Name | N,N,N',N'-tetraethyl-2-propan-2-ylidenebutanediamide |
|---|---|
| PubChem CID | 551898 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | N,N,N',N'-tetraethyl-2-propan-2-ylidenebutanediamide |
| SMILES | CCN(CC)C(=O)CC(C(=O)N(CC)CC)=C(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-7-16(8-2)14(18)11-13(12(5)6)15(19)17(9-3)10-4/h7-11H2,1-6H3 |
| InChIKey | VTAQSXYOCWFOFA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|