C16H21BrF2 — CID 55192642
1-[(2-bromo-5-propylcyclohexyl)methyl]-2,3-difluorobenzene (PubChem CID 55192642) has the molecular formula C16H21BrF2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 1-[(2-bromo-5-propylcyclohexyl)methyl]-2,3-difluorobenzene.
| Compound Name | 1-[(2-bromo-5-propylcyclohexyl)methyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 55192642 |
| Molecular Formula | C16H21BrF2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-[(2-bromo-5-propylcyclohexyl)methyl]-2,3-difluorobenzene |
| SMILES | CCCC1CCC(Br)C(Cc2cccc(F)c2F)C1 |
| InChI | InChI=1S/C16H21BrF2/c1-2-4-11-7-8-14(17)13(9-11)10-12-5-3-6-15(18)16(12)19/h3,5-6,11,13-14H,2,4,7-10H2,1H3 |
| InChIKey | ZPGFHWDCHRDZPU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|