C16H21ClFNO2 — CID 107350544
1-[(2-chloro-5-propylcyclohexyl)methyl]-2-fluoro-3-nitrobenzene (PubChem CID 107350544) has the molecular formula C16H21ClFNO2 and a molecular weight of 313.80 g/mol. Its IUPAC name is 1-[(2-chloro-5-propylcyclohexyl)methyl]-2-fluoro-3-nitrobenzene.
| Compound Name | 1-[(2-chloro-5-propylcyclohexyl)methyl]-2-fluoro-3-nitrobenzene |
|---|---|
| PubChem CID | 107350544 |
| Molecular Formula | C16H21ClFNO2 |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-[(2-chloro-5-propylcyclohexyl)methyl]-2-fluoro-3-nitrobenzene |
| SMILES | CCCC1CCC(Cl)C(Cc2cccc([N+](=O)[O-])c2F)C1 |
| InChI | InChI=1S/C16H21ClFNO2/c1-2-4-11-7-8-14(17)13(9-11)10-12-5-3-6-15(16(12)18)19(20)21/h3,5-6,11,13-14H,2,4,7-10H2,1H3 |
| InChIKey | QJYFSKMYRGJCGF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|