C16H22ClI — CID 65476334
1-[(2-chloro-5-propylcyclohexyl)methyl]-4-iodobenzene (PubChem CID 65476334) has the molecular formula C16H22ClI and a molecular weight of 376.71 g/mol. Its IUPAC name is 1-[(2-chloro-5-propylcyclohexyl)methyl]-4-iodobenzene.
| Compound Name | 1-[(2-chloro-5-propylcyclohexyl)methyl]-4-iodobenzene |
|---|---|
| PubChem CID | 65476334 |
| Molecular Formula | C16H22ClI |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 1-[(2-chloro-5-propylcyclohexyl)methyl]-4-iodobenzene |
| SMILES | CCCC1CCC(Cl)C(Cc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C16H22ClI/c1-2-3-12-6-9-16(17)14(10-12)11-13-4-7-15(18)8-5-13/h4-5,7-8,12,14,16H,2-3,6,9-11H2,1H3 |
| InChIKey | UJYDHUASUUNOKJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|