C17H24ClNO2 — CID 63461874
1-[2-(2-chloro-5-propylcyclohexyl)ethyl]-4-nitrobenzene (PubChem CID 63461874) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 1-[2-(2-chloro-5-propylcyclohexyl)ethyl]-4-nitrobenzene.
| Compound Name | 1-[2-(2-chloro-5-propylcyclohexyl)ethyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 63461874 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-[2-(2-chloro-5-propylcyclohexyl)ethyl]-4-nitrobenzene |
| SMILES | CCCC1CCC(Cl)C(CCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H24ClNO2/c1-2-3-14-7-11-17(18)15(12-14)8-4-13-5-9-16(10-6-13)19(20)21/h5-6,9-10,14-15,17H,2-4,7-8,11-12H2,1H3 |
| InChIKey | KZKUMFJRKLRESO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|