C16H22N2 — CID 55196536
6-butan-2-yl-N,2,3-trimethylquinolin-4-amine (PubChem CID 55196536) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 6-butan-2-yl-N,2,3-trimethylquinolin-4-amine.
| Compound Name | 6-butan-2-yl-N,2,3-trimethylquinolin-4-amine |
|---|---|
| PubChem CID | 55196536 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 6-butan-2-yl-N,2,3-trimethylquinolin-4-amine |
| SMILES | CCC(C)c1ccc2nc(C)c(C)c(NC)c2c1 |
| InChI | InChI=1S/C16H22N2/c1-6-10(2)13-7-8-15-14(9-13)16(17-5)11(3)12(4)18-15/h7-10H,6H2,1-5H3,(H,17,18) |
| InChIKey | COAPBMHPVQQAAI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |