C14H21F2N3 — CID 55203728
1-N-[2-[cyclopentyl(methyl)amino]ethyl]-2,6-difluorobenzene-1,4-diamine (PubChem CID 55203728) has the molecular formula C14H21F2N3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-N-[2-[cyclopentyl(methyl)amino]ethyl]-2,6-difluorobenzene-1,4-diamine.
| Compound Name | 1-N-[2-[cyclopentyl(methyl)amino]ethyl]-2,6-difluorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 55203728 |
| Molecular Formula | C14H21F2N3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-N-[2-[cyclopentyl(methyl)amino]ethyl]-2,6-difluorobenzene-1,4-diamine |
| SMILES | CN(CCNc1c(F)cc(N)cc1F)C1CCCC1 |
| InChI | InChI=1S/C14H21F2N3/c1-19(11-4-2-3-5-11)7-6-18-14-12(15)8-10(17)9-13(14)16/h8-9,11,18H,2-7,17H2,1H3 |
| InChIKey | HHXSADMZQDWKNE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|