C11H19N5O — CID 55206025
2-[2-(3-aminopyrazol-1-yl)ethyl-methylamino]-N-cyclopropylacetamide (PubChem CID 55206025) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-[2-(3-aminopyrazol-1-yl)ethyl-methylamino]-N-cyclopropylacetamide.
| Compound Name | 2-[2-(3-aminopyrazol-1-yl)ethyl-methylamino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 55206025 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-[2-(3-aminopyrazol-1-yl)ethyl-methylamino]-N-cyclopropylacetamide |
| SMILES | CN(CCn1ccc(N)n1)CC(=O)NC1CC1 |
| InChI | InChI=1S/C11H19N5O/c1-15(8-11(17)13-9-2-3-9)6-7-16-5-4-10(12)14-16/h4-5,9H,2-3,6-8H2,1H3,(H2,12,14)(H,13,17) |
| InChIKey | RPPDRZMLADWNEW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |