C11H15N3O2 — CID 55207137
2-cyano-2-ethyl-N-(3-methyl-1,2-oxazol-5-yl)butanamide (PubChem CID 55207137) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-cyano-2-ethyl-N-(3-methyl-1,2-oxazol-5-yl)butanamide.
| Compound Name | 2-cyano-2-ethyl-N-(3-methyl-1,2-oxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 55207137 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-cyano-2-ethyl-N-(3-methyl-1,2-oxazol-5-yl)butanamide |
| SMILES | CCC(C#N)(CC)C(=O)Nc1cc(C)no1 |
| InChI | InChI=1S/C11H15N3O2/c1-4-11(5-2,7-12)10(15)13-9-6-8(3)14-16-9/h6H,4-5H2,1-3H3,(H,13,15) |
| InChIKey | RXHPBKDCFRZTMV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |