ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate

C11H18N2O3 — CID 55207786

IUPACethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate
SMILESCCCN(CC(=O)OCC)Cc1cnoc1
InChIInChI=1S/C11H18N2O3/c1-3-5-13(8-11(14)15-4-2)7-10-6-12-16-9-10/h6,9H,3-5,7-8H2,1-2H3
InChIKeyZLRUPNZUYIPWGE-UHFFFAOYSA-N
MW226.28 g/mol
LogP1.45
Rot. Bonds7

About ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate

ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate (PubChem CID 55207786) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate.

Molecular Properties

Compound Nameethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate
PubChem CID55207786
Molecular FormulaC11H18N2O3
Molecular Weight226.28 g/mol
Exact Mass226.13
IUPAC Nameethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate
SMILESCCCN(CC(=O)OCC)Cc1cnoc1
InChIInChI=1S/C11H18N2O3/c1-3-5-13(8-11(14)15-4-2)7-10-6-12-16-9-10/h6,9H,3-5,7-8H2,1-2H3
InChIKeyZLRUPNZUYIPWGE-UHFFFAOYSA-N
XLogP1.45
TPSA55.57 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.28
LogP ≤ 51.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate?
The IUPAC name of ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate (CID 55207786) is ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate.
What is the SMILES notation for ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate?
The canonical SMILES for ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate is CCCN(CC(=O)OCC)Cc1cnoc1.
What is the InChIKey of ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate?
The InChIKey is ZLRUPNZUYIPWGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-3-5-13(8-11(14)15-4-2)7-10-6-12-16-9-10/h6,9H,3-5,7-8H2,1-2H3.
What are the key properties of ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate?
ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate has a molecular weight of 226.28 g/mol, XLogP of 1.45, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate is sourced from PubChem (CID 55207786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).