C11H18N2O3 — CID 55207786
ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate (PubChem CID 55207786) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate.
| Compound Name | ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate |
|---|---|
| PubChem CID | 55207786 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethyl 2-[1,2-oxazol-4-ylmethyl(propyl)amino]acetate |
| SMILES | CCCN(CC(=O)OCC)Cc1cnoc1 |
| InChI | InChI=1S/C11H18N2O3/c1-3-5-13(8-11(14)15-4-2)7-10-6-12-16-9-10/h6,9H,3-5,7-8H2,1-2H3 |
| InChIKey | ZLRUPNZUYIPWGE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |