C16H29N3O2 — CID 64780042
ethyl 2-[(1-pentan-3-ylpyrazol-3-yl)methyl-propylamino]acetate (PubChem CID 64780042) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is ethyl 2-[(1-pentan-3-ylpyrazol-3-yl)methyl-propylamino]acetate.
| Compound Name | ethyl 2-[(1-pentan-3-ylpyrazol-3-yl)methyl-propylamino]acetate |
|---|---|
| PubChem CID | 64780042 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | ethyl 2-[(1-pentan-3-ylpyrazol-3-yl)methyl-propylamino]acetate |
| SMILES | CCCN(CC(=O)OCC)Cc1ccn(C(CC)CC)n1 |
| InChI | InChI=1S/C16H29N3O2/c1-5-10-18(13-16(20)21-8-4)12-14-9-11-19(17-14)15(6-2)7-3/h9,11,15H,5-8,10,12-13H2,1-4H3 |
| InChIKey | NDZNMQINILDXCF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |