C15H28N4S — CID 64800753
3-[ethyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]-2-methylpropanethioamide (PubChem CID 64800753) has the molecular formula C15H28N4S and a molecular weight of 296.48 g/mol. Its IUPAC name is 3-[ethyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]-2-methylpropanethioamide.
| Compound Name | 3-[ethyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 64800753 |
| Molecular Formula | C15H28N4S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 3-[ethyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]-2-methylpropanethioamide |
| SMILES | CCC(CC)n1ccc(CN(CC)CC(C)C(N)=S)n1 |
| InChI | InChI=1S/C15H28N4S/c1-5-14(6-2)19-9-8-13(17-19)11-18(7-3)10-12(4)15(16)20/h8-9,12,14H,5-7,10-11H2,1-4H3,(H2,16,20) |
| InChIKey | JRJFTLHOTQZZNS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|