C15H27N3O2 — CID 64784229
3-[ethyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]-2-methylpropanoic acid (PubChem CID 64784229) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-[ethyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[ethyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 64784229 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3-[ethyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]-2-methylpropanoic acid |
| SMILES | CCC(CC)n1ccc(CN(CC)CC(C)C(=O)O)n1 |
| InChI | InChI=1S/C15H27N3O2/c1-5-14(6-2)18-9-8-13(16-18)11-17(7-3)10-12(4)15(19)20/h8-9,12,14H,5-7,10-11H2,1-4H3,(H,19,20) |
| InChIKey | GSAFOZMIZYAXDL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |