C16H29N3O2 — CID 64784799
3-[tert-butyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]propanoic acid (PubChem CID 64784799) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 3-[tert-butyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]propanoic acid.
| Compound Name | 3-[tert-butyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 64784799 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 3-[tert-butyl-[(1-pentan-3-ylpyrazol-3-yl)methyl]amino]propanoic acid |
| SMILES | CCC(CC)n1ccc(CN(CCC(=O)O)C(C)(C)C)n1 |
| InChI | InChI=1S/C16H29N3O2/c1-6-14(7-2)19-11-8-13(17-19)12-18(16(3,4)5)10-9-15(20)21/h8,11,14H,6-7,9-10,12H2,1-5H3,(H,20,21) |
| InChIKey | GORBFUDIQXTQLO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |