C10H10F2N2O3S — CID 55212722
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-2,2-difluoroacetohydrazide (PubChem CID 55212722) has the molecular formula C10H10F2N2O3S and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-2,2-difluoroacetohydrazide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-2,2-difluoroacetohydrazide |
|---|---|
| PubChem CID | 55212722 |
| Molecular Formula | C10H10F2N2O3S |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-2,2-difluoroacetohydrazide |
| SMILES | NNC(=O)C(F)(F)Sc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C10H10F2N2O3S/c11-10(12,9(15)14-13)18-6-1-2-7-8(5-6)17-4-3-16-7/h1-2,5H,3-4,13H2,(H,14,15) |
| InChIKey | TUPASRVGXHYFMM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|