C11H16N6O2 — CID 55214989
1-[2-[furan-2-ylmethyl(methyl)amino]ethyl]triazole-4-carbohydrazide (PubChem CID 55214989) has the molecular formula C11H16N6O2 and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-[2-[furan-2-ylmethyl(methyl)amino]ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-[furan-2-ylmethyl(methyl)amino]ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55214989 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-[2-[furan-2-ylmethyl(methyl)amino]ethyl]triazole-4-carbohydrazide |
| SMILES | CN(CCn1cc(C(=O)NN)nn1)Cc1ccco1 |
| InChI | InChI=1S/C11H16N6O2/c1-16(7-9-3-2-6-19-9)4-5-17-8-10(14-15-17)11(18)13-12/h2-3,6,8H,4-5,7,12H2,1H3,(H,13,18) |
| InChIKey | PSZNJWFHGKTYDP-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|