C13H17FN6O — CID 63583992
1-[2-(N-ethyl-2-fluoroanilino)ethyl]triazole-4-carbohydrazide (PubChem CID 63583992) has the molecular formula C13H17FN6O and a molecular weight of 292.32 g/mol. Its IUPAC name is 1-[2-(N-ethyl-2-fluoroanilino)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(N-ethyl-2-fluoroanilino)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63583992 |
| Molecular Formula | C13H17FN6O |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-[2-(N-ethyl-2-fluoroanilino)ethyl]triazole-4-carbohydrazide |
| SMILES | CCN(CCn1cc(C(=O)NN)nn1)c1ccccc1F |
| InChI | InChI=1S/C13H17FN6O/c1-2-19(12-6-4-3-5-10(12)14)7-8-20-9-11(17-18-20)13(21)16-15/h3-6,9H,2,7-8,15H2,1H3,(H,16,21) |
| InChIKey | BLDACZMGQGHPLK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|