C12H25N7O — CID 63584216
1-[2-[2-(dimethylamino)ethyl-propylamino]ethyl]triazole-4-carbohydrazide (PubChem CID 63584216) has the molecular formula C12H25N7O and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-[2-[2-(dimethylamino)ethyl-propylamino]ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-[2-(dimethylamino)ethyl-propylamino]ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63584216 |
| Molecular Formula | C12H25N7O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 1-[2-[2-(dimethylamino)ethyl-propylamino]ethyl]triazole-4-carbohydrazide |
| SMILES | CCCN(CCN(C)C)CCn1cc(C(=O)NN)nn1 |
| InChI | InChI=1S/C12H25N7O/c1-4-5-18(7-6-17(2)3)8-9-19-10-11(15-16-19)12(20)14-13/h10H,4-9,13H2,1-3H3,(H,14,20) |
| InChIKey | IYPLYXHEFGLRBX-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|