C15H25N3 — CID 55216576
(1S)-1-[2-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine (PubChem CID 55216576) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (1S)-1-[2-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine.
| Compound Name | (1S)-1-[2-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 55216576 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (1S)-1-[2-(3,3,4-trimethylpiperazin-1-yl)phenyl]ethanamine |
| SMILES | C[C@H](N)c1ccccc1N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C15H25N3/c1-12(16)13-7-5-6-8-14(13)18-10-9-17(4)15(2,3)11-18/h5-8,12H,9-11,16H2,1-4H3/t12-/m0/s1 |
| InChIKey | KPGPPPUXZLHXJR-LBPRGKRZSA-N |
| XLogP | 2.24 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |