C12H18N2OS — CID 63368754
(1S)-1-[2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanamine (PubChem CID 63368754) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is (1S)-1-[2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanamine.
| Compound Name | (1S)-1-[2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 63368754 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (1S)-1-[2-(1-oxo-1,4-thiazinan-4-yl)phenyl]ethanamine |
| SMILES | C[C@H](N)c1ccccc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C12H18N2OS/c1-10(13)11-4-2-3-5-12(11)14-6-8-16(15)9-7-14/h2-5,10H,6-9,13H2,1H3/t10-/m0/s1 |
| InChIKey | OSBVLCYACKIUEJ-JTQLQIEISA-N |
| XLogP | 1.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |