C11H9FN4O2S — CID 55232694
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-5-fluorobenzoic acid (PubChem CID 55232694) has the molecular formula C11H9FN4O2S and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-5-fluorobenzoic acid.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 55232694 |
| Molecular Formula | C11H9FN4O2S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-5-fluorobenzoic acid |
| SMILES | Nc1cc(N)nc(Sc2ccc(F)cc2C(=O)O)n1 |
| InChI | InChI=1S/C11H9FN4O2S/c12-5-1-2-7(6(3-5)10(17)18)19-11-15-8(13)4-9(14)16-11/h1-4H,(H,17,18)(H4,13,14,15,16) |
| InChIKey | SMTODVTXAVDQTP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |