C14H14F2N2S — CID 55234728
2-cyclopentyl-4-(2,3-difluorophenyl)-1,3-thiazol-5-amine (PubChem CID 55234728) has the molecular formula C14H14F2N2S and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-cyclopentyl-4-(2,3-difluorophenyl)-1,3-thiazol-5-amine.
| Compound Name | 2-cyclopentyl-4-(2,3-difluorophenyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 55234728 |
| Molecular Formula | C14H14F2N2S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-cyclopentyl-4-(2,3-difluorophenyl)-1,3-thiazol-5-amine |
| SMILES | Nc1sc(C2CCCC2)nc1-c1cccc(F)c1F |
| InChI | InChI=1S/C14H14F2N2S/c15-10-7-3-6-9(11(10)16)12-13(17)19-14(18-12)8-4-1-2-5-8/h3,6-8H,1-2,4-5,17H2 |
| InChIKey | XTSUYDTZUWETGF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |