C14H17FN2S2 — CID 55238694
N-[[5-fluoro-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]-2-methylpropan-1-amine (PubChem CID 55238694) has the molecular formula C14H17FN2S2 and a molecular weight of 296.44 g/mol. Its IUPAC name is N-[[5-fluoro-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[5-fluoro-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 55238694 |
| Molecular Formula | C14H17FN2S2 |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[[5-fluoro-2-(1,3-thiazol-2-ylsulfanyl)phenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cc(F)ccc1Sc1nccs1 |
| InChI | InChI=1S/C14H17FN2S2/c1-10(2)8-16-9-11-7-12(15)3-4-13(11)19-14-17-5-6-18-14/h3-7,10,16H,8-9H2,1-2H3 |
| InChIKey | BLKTWCCRUYLKIR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|