C10H10NS+ — CID 11608559
3-benzyl-1,3-thiazol-3-ium (PubChem CID 11608559) has the molecular formula C10H10NS+ and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-benzyl-1,3-thiazol-3-ium.
| Compound Name | 3-benzyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 11608559 |
| Molecular Formula | C10H10NS+ |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 3-benzyl-1,3-thiazol-3-ium |
| SMILES | c1ccc(C[n+]2ccsc2)cc1 |
| InChI | InChI=1S/C10H10NS/c1-2-4-10(5-3-1)8-11-6-7-12-9-11/h1-7,9H,8H2/q+1 |
| InChIKey | VRBQHWBVNLNLOZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|